C13H16F3N3O2S — CID 125423927
(9aR)-8-[5-(trifluoromethyl)-2-pyridinyl]-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]thiazine 2,2-dioxide (PubChem CID 125423927) has the molecular formula C13H16F3N3O2S and a molecular weight of 335.35 g/mol. Its IUPAC name is (9aR)-8-[5-(trifluoromethyl)-2-pyridinyl]-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]thiazine 2,2-dioxide.
| Compound Name | (9aR)-8-[5-(trifluoromethyl)-2-pyridinyl]-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]thiazine 2,2-dioxide |
|---|---|
| PubChem CID | 125423927 |
| Molecular Formula | C13H16F3N3O2S |
| Molecular Weight | 335.35 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | (9aR)-8-[5-(trifluoromethyl)-2-pyridinyl]-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]thiazine 2,2-dioxide |
| SMILES | O=S1(=O)CCN2CCN(c3ccc(C(F)(F)F)cn3)C[C@@H]2C1 |
| InChI | InChI=1S/C13H16F3N3O2S/c14-13(15,16)10-1-2-12(17-7-10)19-4-3-18-5-6-22(20,21)9-11(18)8-19/h1-2,7,11H,3-6,8-9H2/t11-/m1/s1 |
| InChIKey | MRVPXYJXGXUJDA-LLVKDONJSA-N |
| XLogP | 1.02 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.35 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |