C19H27F3N4 — CID 24876993
1-[(1-cyclopropylpiperidin-3-yl)methyl]-4-[5-(trifluoromethyl)-2-pyridinyl]piperazine (PubChem CID 24876993) has the molecular formula C19H27F3N4 and a molecular weight of 368.45 g/mol. Its IUPAC name is 1-[(1-cyclopropylpiperidin-3-yl)methyl]-4-[5-(trifluoromethyl)-2-pyridinyl]piperazine.
| Compound Name | 1-[(1-cyclopropylpiperidin-3-yl)methyl]-4-[5-(trifluoromethyl)-2-pyridinyl]piperazine |
|---|---|
| PubChem CID | 24876993 |
| Molecular Formula | C19H27F3N4 |
| Molecular Weight | 368.45 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | 1-[(1-cyclopropylpiperidin-3-yl)methyl]-4-[5-(trifluoromethyl)-2-pyridinyl]piperazine |
| SMILES | FC(F)(F)c1ccc(N2CCN(CC3CCCN(C4CC4)C3)CC2)nc1 |
| InChI | InChI=1S/C19H27F3N4/c20-19(21,22)16-3-6-18(23-12-16)25-10-8-24(9-11-25)13-15-2-1-7-26(14-15)17-4-5-17/h3,6,12,15,17H,1-2,4-5,7-11,13-14H2 |
| InChIKey | PQRYCXGKSSFLBP-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 22.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.45 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |