C16H22F3N3O — CID 138997912
1-(oxan-3-yl)-4-[5-(trifluoromethyl)-2-pyridinyl]-1,4-diazepane (PubChem CID 138997912) has the molecular formula C16H22F3N3O and a molecular weight of 329.37 g/mol. Its IUPAC name is 1-(oxan-3-yl)-4-[5-(trifluoromethyl)-2-pyridinyl]-1,4-diazepane.
| Compound Name | 1-(oxan-3-yl)-4-[5-(trifluoromethyl)-2-pyridinyl]-1,4-diazepane |
|---|---|
| PubChem CID | 138997912 |
| Molecular Formula | C16H22F3N3O |
| Molecular Weight | 329.37 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | 1-(oxan-3-yl)-4-[5-(trifluoromethyl)-2-pyridinyl]-1,4-diazepane |
| SMILES | FC(F)(F)c1ccc(N2CCCN(C3CCCOC3)CC2)nc1 |
| InChI | InChI=1S/C16H22F3N3O/c17-16(18,19)13-4-5-15(20-11-13)22-7-2-6-21(8-9-22)14-3-1-10-23-12-14/h4-5,11,14H,1-3,6-10,12H2 |
| InChIKey | GHALFSXMEAOJCU-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.37 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |