C12H14ClF8I — CID 125476127
[(1R)-6-chloro-3,3,4,4,5,5,6,6-octafluoro-1-iodohexyl]cyclohexane (PubChem CID 125476127) has the molecular formula C12H14ClF8I and a molecular weight of 472.59 g/mol. Its IUPAC name is [(1R)-6-chloro-3,3,4,4,5,5,6,6-octafluoro-1-iodohexyl]cyclohexane.
| Compound Name | [(1R)-6-chloro-3,3,4,4,5,5,6,6-octafluoro-1-iodohexyl]cyclohexane |
|---|---|
| PubChem CID | 125476127 |
| Molecular Formula | C12H14ClF8I |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 471.97 |
| IUPAC Name | [(1R)-6-chloro-3,3,4,4,5,5,6,6-octafluoro-1-iodohexyl]cyclohexane |
| SMILES | FC(F)(Cl)C(F)(F)C(F)(F)C(F)(F)C[C@@H](I)C1CCCCC1 |
| InChI | InChI=1S/C12H14ClF8I/c13-12(20,21)11(18,19)10(16,17)9(14,15)6-8(22)7-4-2-1-3-5-7/h7-8H,1-6H2/t8-/m1/s1 |
| InChIKey | UGRWYHAKRZJJQE-MRVPVSSYSA-N |
| XLogP | 6.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|