C19H28N2O2 — CID 125479268
(1R,2R,4R)-4-[(4-methoxyphenyl)methoxy]-2-N,2-N-bis(prop-2-enyl)cyclopentane-1,2-diamine (PubChem CID 125479268) has the molecular formula C19H28N2O2 and a molecular weight of 316.44 g/mol. Its IUPAC name is (1R,2R,4R)-4-[(4-methoxyphenyl)methoxy]-2-N,2-N-bis(prop-2-enyl)cyclopentane-1,2-diamine.
| Compound Name | (1R,2R,4R)-4-[(4-methoxyphenyl)methoxy]-2-N,2-N-bis(prop-2-enyl)cyclopentane-1,2-diamine |
|---|---|
| PubChem CID | 125479268 |
| Molecular Formula | C19H28N2O2 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | (1R,2R,4R)-4-[(4-methoxyphenyl)methoxy]-2-N,2-N-bis(prop-2-enyl)cyclopentane-1,2-diamine |
| SMILES | C=CCN(CC=C)[C@@H]1C[C@H](OCc2ccc(OC)cc2)C[C@H]1N |
| InChI | InChI=1S/C19H28N2O2/c1-4-10-21(11-5-2)19-13-17(12-18(19)20)23-14-15-6-8-16(22-3)9-7-15/h4-9,17-19H,1-2,10-14,20H2,3H3/t17-,18-,19-/m1/s1 |
| InChIKey | HVYLUHTUNZIPNA-GUDVDZBRSA-N |
| XLogP | 2.74 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|