C13H16FNO4S — CID 125480931
[(2S,3aS,6aS)-1-(4-fluorophenyl)sulfonyl-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-2-yl]methanol (PubChem CID 125480931) has the molecular formula C13H16FNO4S and a molecular weight of 301.34 g/mol. Its IUPAC name is [(2S,3aS,6aS)-1-(4-fluorophenyl)sulfonyl-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-2-yl]methanol.
| Compound Name | [(2S,3aS,6aS)-1-(4-fluorophenyl)sulfonyl-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-2-yl]methanol |
|---|---|
| PubChem CID | 125480931 |
| Molecular Formula | C13H16FNO4S |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | [(2S,3aS,6aS)-1-(4-fluorophenyl)sulfonyl-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-2-yl]methanol |
| SMILES | O=S(=O)(c1ccc(F)cc1)N1[C@H](CO)C[C@@H]2COC[C@H]21 |
| InChI | InChI=1S/C13H16FNO4S/c14-10-1-3-12(4-2-10)20(17,18)15-11(6-16)5-9-7-19-8-13(9)15/h1-4,9,11,13,16H,5-8H2/t9-,11+,13-/m1/s1 |
| InChIKey | ADHHJOWXNYATKJ-SUZMYJTESA-N |
| XLogP | 0.60 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |