C15H20O3 — CID 125481556
(2S,3R)-5,7-dihydroxy-3-methyl-2-pentyl-2,3-dihydroinden-1-one (PubChem CID 125481556) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is (2S,3R)-5,7-dihydroxy-3-methyl-2-pentyl-2,3-dihydroinden-1-one.
| Compound Name | (2S,3R)-5,7-dihydroxy-3-methyl-2-pentyl-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 125481556 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | (2S,3R)-5,7-dihydroxy-3-methyl-2-pentyl-2,3-dihydroinden-1-one |
| SMILES | CCCCC[C@@H]1C(=O)c2c(O)cc(O)cc2[C@@H]1C |
| InChI | InChI=1S/C15H20O3/c1-3-4-5-6-11-9(2)12-7-10(16)8-13(17)14(12)15(11)18/h7-9,11,16-17H,3-6H2,1-2H3/t9-,11+/m1/s1 |
| InChIKey | TYXLGHQENJLLFU-KOLCDFICSA-N |
| XLogP | 3.59 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|