C16H21NO2 — CID 125483663
(2R,3E,4aS,8aS)-3-hydroxyimino-2-phenyl-1,4,4a,5,6,7,8,8a-octahydronaphthalen-2-ol (PubChem CID 125483663) has the molecular formula C16H21NO2 and a molecular weight of 259.35 g/mol. Its IUPAC name is (2R,3E,4aS,8aS)-3-hydroxyimino-2-phenyl-1,4,4a,5,6,7,8,8a-octahydronaphthalen-2-ol.
| Compound Name | (2R,3E,4aS,8aS)-3-hydroxyimino-2-phenyl-1,4,4a,5,6,7,8,8a-octahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 125483663 |
| Molecular Formula | C16H21NO2 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | (2R,3E,4aS,8aS)-3-hydroxyimino-2-phenyl-1,4,4a,5,6,7,8,8a-octahydronaphthalen-2-ol |
| SMILES | O/N=C1\C[C@@H]2CCCC[C@H]2C[C@@]1(O)c1ccccc1 |
| InChI | InChI=1S/C16H21NO2/c18-16(14-8-2-1-3-9-14)11-13-7-5-4-6-12(13)10-15(16)17-19/h1-3,8-9,12-13,18-19H,4-7,10-11H2/b17-15+/t12-,13-,16+/m0/s1 |
| InChIKey | KMELCHREZIDTNB-VZCSLJDYSA-N |
| XLogP | 3.30 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|