C9H17N3 — CID 12551425
2-cyclohexyl-3,4-dihydropyrazol-5-amine (PubChem CID 12551425) has the molecular formula C9H17N3 and a molecular weight of 167.26 g/mol. Its IUPAC name is 2-cyclohexyl-3,4-dihydropyrazol-5-amine.
| Compound Name | 2-cyclohexyl-3,4-dihydropyrazol-5-amine |
|---|---|
| PubChem CID | 12551425 |
| Molecular Formula | C9H17N3 |
| Molecular Weight | 167.26 g/mol |
| Exact Mass | 167.14 |
| IUPAC Name | 2-cyclohexyl-3,4-dihydropyrazol-5-amine |
| SMILES | NC1=NN(C2CCCCC2)CC1 |
| InChI | InChI=1S/C9H17N3/c10-9-6-7-12(11-9)8-4-2-1-3-5-8/h8H,1-7H2,(H2,10,11) |
| InChIKey | GXWWQUZUAVXGIZ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.26 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |