C10H19N3 — CID 83240724
2-cycloheptyl-3,4-dihydropyrazol-5-amine (PubChem CID 83240724) has the molecular formula C10H19N3 and a molecular weight of 181.28 g/mol. Its IUPAC name is 2-cycloheptyl-3,4-dihydropyrazol-5-amine.
| Compound Name | 2-cycloheptyl-3,4-dihydropyrazol-5-amine |
|---|---|
| PubChem CID | 83240724 |
| Molecular Formula | C10H19N3 |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.16 |
| IUPAC Name | 2-cycloheptyl-3,4-dihydropyrazol-5-amine |
| SMILES | NC1=NN(C2CCCCCC2)CC1 |
| InChI | InChI=1S/C10H19N3/c11-10-7-8-13(12-10)9-5-3-1-2-4-6-9/h9H,1-8H2,(H2,11,12) |
| InChIKey | SAZLFSCEKJLKNS-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |