C15H26S — CID 12574117
9-ethyl-2,3,4,4a,5,6,7,8,8a,9,9a,10a-dodecahydro-1H-thioxanthene (PubChem CID 12574117) has the molecular formula C15H26S and a molecular weight of 238.44 g/mol. Its IUPAC name is 9-ethyl-2,3,4,4a,5,6,7,8,8a,9,9a,10a-dodecahydro-1H-thioxanthene.
| Compound Name | 9-ethyl-2,3,4,4a,5,6,7,8,8a,9,9a,10a-dodecahydro-1H-thioxanthene |
|---|---|
| PubChem CID | 12574117 |
| Molecular Formula | C15H26S |
| Molecular Weight | 238.44 g/mol |
| Exact Mass | 238.18 |
| IUPAC Name | 9-ethyl-2,3,4,4a,5,6,7,8,8a,9,9a,10a-dodecahydro-1H-thioxanthene |
| SMILES | CCC1C2CCCCC2SC2CCCCC21 |
| InChI | InChI=1S/C15H26S/c1-2-11-12-7-3-5-9-14(12)16-15-10-6-4-8-13(11)15/h11-15H,2-10H2,1H3 |
| InChIKey | NEAWEDNQGXWETC-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.44 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |