C16H16Cl6O2 — CID 12577000
2-[[5-(1,4,5,6,7,7-hexachloro-2-bicyclo[2.2.1]hept-5-enyl)-2-methylpent-3-yn-2-yl]oxymethyl]oxirane (PubChem CID 12577000) has the molecular formula C16H16Cl6O2 and a molecular weight of 453.02 g/mol. Its IUPAC name is 2-[[5-(1,4,5,6,7,7-hexachloro-2-bicyclo[2.2.1]hept-5-enyl)-2-methylpent-3-yn-2-yl]oxymethyl]oxirane.
| Compound Name | 2-[[5-(1,4,5,6,7,7-hexachloro-2-bicyclo[2.2.1]hept-5-enyl)-2-methylpent-3-yn-2-yl]oxymethyl]oxirane |
|---|---|
| PubChem CID | 12577000 |
| Molecular Formula | C16H16Cl6O2 |
| Molecular Weight | 453.02 g/mol |
| Exact Mass | 449.93 |
| IUPAC Name | 2-[[5-(1,4,5,6,7,7-hexachloro-2-bicyclo[2.2.1]hept-5-enyl)-2-methylpent-3-yn-2-yl]oxymethyl]oxirane |
| SMILES | CC(C)(C#CCC1CC2(Cl)C(Cl)=C(Cl)C1(Cl)C2(Cl)Cl)OCC1CO1 |
| InChI | InChI=1S/C16H16Cl6O2/c1-13(2,24-8-10-7-23-10)5-3-4-9-6-14(19)11(17)12(18)15(9,20)16(14,21)22/h9-10H,4,6-8H2,1-2H3 |
| InChIKey | NGJWUNYRMWWLRV-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.02 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|