C8H5F10NO3 — CID 12589532
2-(2,2,3,3,3-pentafluoropropanoylamino)ethyl 2,2,3,3,3-pentafluoropropanoate (PubChem CID 12589532) has the molecular formula C8H5F10NO3 and a molecular weight of 353.11 g/mol. Its IUPAC name is 2-(2,2,3,3,3-pentafluoropropanoylamino)ethyl 2,2,3,3,3-pentafluoropropanoate.
| Compound Name | 2-(2,2,3,3,3-pentafluoropropanoylamino)ethyl 2,2,3,3,3-pentafluoropropanoate |
|---|---|
| PubChem CID | 12589532 |
| Molecular Formula | C8H5F10NO3 |
| Molecular Weight | 353.11 g/mol |
| Exact Mass | 353.01 |
| IUPAC Name | 2-(2,2,3,3,3-pentafluoropropanoylamino)ethyl 2,2,3,3,3-pentafluoropropanoate |
| SMILES | O=C(NCCOC(=O)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H5F10NO3/c9-5(10,7(13,14)15)3(20)19-1-2-22-4(21)6(11,12)8(16,17)18/h1-2H2,(H,19,20) |
| InChIKey | WCWLUXNTNHXCDT-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.11 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|