C18H25N3O — CID 12593747
N-(3,3-dimethyl-1H-furo[3,4-b]quinolin-9-yl)-N',N'-dimethylpropane-1,3-diamine (PubChem CID 12593747) has the molecular formula C18H25N3O and a molecular weight of 299.42 g/mol. Its IUPAC name is N-(3,3-dimethyl-1H-furo[3,4-b]quinolin-9-yl)-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-(3,3-dimethyl-1H-furo[3,4-b]quinolin-9-yl)-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 12593747 |
| Molecular Formula | C18H25N3O |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.20 |
| IUPAC Name | N-(3,3-dimethyl-1H-furo[3,4-b]quinolin-9-yl)-N',N'-dimethylpropane-1,3-diamine |
| SMILES | CN(C)CCCNc1c2c(nc3ccccc13)C(C)(C)OC2 |
| InChI | InChI=1S/C18H25N3O/c1-18(2)17-14(12-22-18)16(19-10-7-11-21(3)4)13-8-5-6-9-15(13)20-17/h5-6,8-9H,7,10-12H2,1-4H3,(H,19,20) |
| InChIKey | VGLOGINYHZIVPC-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|