C10H19B — CID 12603029
3,7-dimethyl-3-borabicyclo[3.3.1]nonane (PubChem CID 12603029) has the molecular formula C10H19B and a molecular weight of 150.07 g/mol. Its IUPAC name is 3,7-dimethyl-3-borabicyclo[3.3.1]nonane.
| Compound Name | 3,7-dimethyl-3-borabicyclo[3.3.1]nonane |
|---|---|
| PubChem CID | 12603029 |
| Molecular Formula | C10H19B |
| Molecular Weight | 150.07 g/mol |
| Exact Mass | 150.16 |
| IUPAC Name | 3,7-dimethyl-3-borabicyclo[3.3.1]nonane |
| SMILES | CB1CC2CC(C)CC(C1)C2 |
| InChI | InChI=1S/C10H19B/c1-8-3-9-5-10(4-8)7-11(2)6-9/h8-10H,3-7H2,1-2H3 |
| InChIKey | DXPDDEZNMAEFGR-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.07 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|