C33H35ClN2O7 — CID 126073455
3-[9-[5-chloro-2-[(4-nitrophenyl)methoxy]phenyl]-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-10-yl]propanoic acid (PubChem CID 126073455) has the molecular formula C33H35ClN2O7 and a molecular weight of 607.10 g/mol. Its IUPAC name is 3-[9-[5-chloro-2-[(4-nitrophenyl)methoxy]phenyl]-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-10-yl]propanoic acid.
| Compound Name | 3-[9-[5-chloro-2-[(4-nitrophenyl)methoxy]phenyl]-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-10-yl]propanoic acid |
|---|---|
| PubChem CID | 126073455 |
| Molecular Formula | C33H35ClN2O7 |
| Molecular Weight | 607.10 g/mol |
| Exact Mass | 606.21 |
| IUPAC Name | 3-[9-[5-chloro-2-[(4-nitrophenyl)methoxy]phenyl]-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-10-yl]propanoic acid |
| SMILES | CC1(C)CC(=O)C2=C(C1)N(CCC(=O)O)C1=C(C(=O)CC(C)(C)C1)C2c1cc(Cl)ccc1OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C33H35ClN2O7/c1-32(2)14-23-30(25(37)16-32)29(31-24(35(23)12-11-28(39)40)15-33(3,4)17-26(31)38)22-13-20(34)7-10-27(22)43-18-19-5-8-21(9-6-19)36(41)42/h5-10,13,29H,11-12,14-18H2,1-4H3,(H,39,40) |
| InChIKey | PAFRCSRVNIERTA-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 127.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.10 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|