C19H21NOS — CID 126115944
(3Z)-3-[(5-ethylthiophen-2-yl)methylidene]-1-(2-methylpropyl)indol-2-one (PubChem CID 126115944) has the molecular formula C19H21NOS and a molecular weight of 311.45 g/mol. Its IUPAC name is (3Z)-3-[(5-ethylthiophen-2-yl)methylidene]-1-(2-methylpropyl)indol-2-one.
| Compound Name | (3Z)-3-[(5-ethylthiophen-2-yl)methylidene]-1-(2-methylpropyl)indol-2-one |
|---|---|
| PubChem CID | 126115944 |
| Molecular Formula | C19H21NOS |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | (3Z)-3-[(5-ethylthiophen-2-yl)methylidene]-1-(2-methylpropyl)indol-2-one |
| SMILES | CCc1ccc(/C=C2\C(=O)N(CC(C)C)c3ccccc32)s1 |
| InChI | InChI=1S/C19H21NOS/c1-4-14-9-10-15(22-14)11-17-16-7-5-6-8-18(16)20(19(17)21)12-13(2)3/h5-11,13H,4,12H2,1-3H3/b17-11- |
| InChIKey | IGOGTVVCKIRZIV-BOPFTXTBSA-N |
| XLogP | 4.85 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|