C23H23N3O7S2 — CID 126121893
ethyl 4-(benzylcarbamoyl)-3-methyl-5-[(2-methyl-5-nitrophenyl)sulfonylamino]thiophene-2-carboxylate (PubChem CID 126121893) has the molecular formula C23H23N3O7S2 and a molecular weight of 517.59 g/mol. Its IUPAC name is ethyl 4-(benzylcarbamoyl)-3-methyl-5-[(2-methyl-5-nitrophenyl)sulfonylamino]thiophene-2-carboxylate.
| Compound Name | ethyl 4-(benzylcarbamoyl)-3-methyl-5-[(2-methyl-5-nitrophenyl)sulfonylamino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 126121893 |
| Molecular Formula | C23H23N3O7S2 |
| Molecular Weight | 517.59 g/mol |
| Exact Mass | 517.10 |
| IUPAC Name | ethyl 4-(benzylcarbamoyl)-3-methyl-5-[(2-methyl-5-nitrophenyl)sulfonylamino]thiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc(NS(=O)(=O)c2cc([N+](=O)[O-])ccc2C)c(C(=O)NCc2ccccc2)c1C |
| InChI | InChI=1S/C23H23N3O7S2/c1-4-33-23(28)20-15(3)19(21(27)24-13-16-8-6-5-7-9-16)22(34-20)25-35(31,32)18-12-17(26(29)30)11-10-14(18)2/h5-12,25H,4,13H2,1-3H3,(H,24,27) |
| InChIKey | MUVUBFXZGPHBRM-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 144.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.59 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|