C25H22ClNO3S — CID 126147925
methyl 2-[[(E)-3-(2-chlorophenyl)-2-phenylprop-2-enoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 126147925) has the molecular formula C25H22ClNO3S and a molecular weight of 451.98 g/mol. Its IUPAC name is methyl 2-[[(E)-3-(2-chlorophenyl)-2-phenylprop-2-enoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | methyl 2-[[(E)-3-(2-chlorophenyl)-2-phenylprop-2-enoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 126147925 |
| Molecular Formula | C25H22ClNO3S |
| Molecular Weight | 451.98 g/mol |
| Exact Mass | 451.10 |
| IUPAC Name | methyl 2-[[(E)-3-(2-chlorophenyl)-2-phenylprop-2-enoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)/C(=C/c2ccccc2Cl)c2ccccc2)sc2c1CCCC2 |
| InChI | InChI=1S/C25H22ClNO3S/c1-30-25(29)22-18-12-6-8-14-21(18)31-24(22)27-23(28)19(16-9-3-2-4-10-16)15-17-11-5-7-13-20(17)26/h2-5,7,9-11,13,15H,6,8,12,14H2,1H3,(H,27,28)/b19-15+ |
| InChIKey | WEEODRARYXIYFR-XDJHFCHBSA-N |
| XLogP | 6.25 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.98 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|