C24H21ClN2O5 — CID 126188698
[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl] 2-chloro-5-(5-formylfuran-2-yl)benzoate (PubChem CID 126188698) has the molecular formula C24H21ClN2O5 and a molecular weight of 452.89 g/mol. Its IUPAC name is [2-oxo-2-(4-phenylpiperazin-1-yl)ethyl] 2-chloro-5-(5-formylfuran-2-yl)benzoate.
| Compound Name | [2-oxo-2-(4-phenylpiperazin-1-yl)ethyl] 2-chloro-5-(5-formylfuran-2-yl)benzoate |
|---|---|
| PubChem CID | 126188698 |
| Molecular Formula | C24H21ClN2O5 |
| Molecular Weight | 452.89 g/mol |
| Exact Mass | 452.11 |
| IUPAC Name | [2-oxo-2-(4-phenylpiperazin-1-yl)ethyl] 2-chloro-5-(5-formylfuran-2-yl)benzoate |
| SMILES | O=Cc1ccc(-c2ccc(Cl)c(C(=O)OCC(=O)N3CCN(c4ccccc4)CC3)c2)o1 |
| InChI | InChI=1S/C24H21ClN2O5/c25-21-8-6-17(22-9-7-19(15-28)32-22)14-20(21)24(30)31-16-23(29)27-12-10-26(11-13-27)18-4-2-1-3-5-18/h1-9,14-15H,10-13,16H2 |
| InChIKey | MESPQYQRDJRZJZ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 80.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.89 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|