C20H12ClF2NO5 — CID 126223818
[2-(2,4-difluoroanilino)-2-oxoethyl] 2-chloro-5-(5-formylfuran-2-yl)benzoate (PubChem CID 126223818) has the molecular formula C20H12ClF2NO5 and a molecular weight of 419.77 g/mol. Its IUPAC name is [2-(2,4-difluoroanilino)-2-oxoethyl] 2-chloro-5-(5-formylfuran-2-yl)benzoate.
| Compound Name | [2-(2,4-difluoroanilino)-2-oxoethyl] 2-chloro-5-(5-formylfuran-2-yl)benzoate |
|---|---|
| PubChem CID | 126223818 |
| Molecular Formula | C20H12ClF2NO5 |
| Molecular Weight | 419.77 g/mol |
| Exact Mass | 419.04 |
| IUPAC Name | [2-(2,4-difluoroanilino)-2-oxoethyl] 2-chloro-5-(5-formylfuran-2-yl)benzoate |
| SMILES | O=Cc1ccc(-c2ccc(Cl)c(C(=O)OCC(=O)Nc3ccc(F)cc3F)c2)o1 |
| InChI | InChI=1S/C20H12ClF2NO5/c21-15-4-1-11(18-6-3-13(9-25)29-18)7-14(15)20(27)28-10-19(26)24-17-5-2-12(22)8-16(17)23/h1-9H,10H2,(H,24,26) |
| InChIKey | QUSADSVRNFLAFD-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.77 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|