C21H13ClF3NO5 — CID 126416799
[2-oxo-2-[3-(trifluoromethyl)anilino]ethyl] 2-chloro-5-(5-formylfuran-2-yl)benzoate (PubChem CID 126416799) has the molecular formula C21H13ClF3NO5 and a molecular weight of 451.78 g/mol. Its IUPAC name is [2-oxo-2-[3-(trifluoromethyl)anilino]ethyl] 2-chloro-5-(5-formylfuran-2-yl)benzoate.
| Compound Name | [2-oxo-2-[3-(trifluoromethyl)anilino]ethyl] 2-chloro-5-(5-formylfuran-2-yl)benzoate |
|---|---|
| PubChem CID | 126416799 |
| Molecular Formula | C21H13ClF3NO5 |
| Molecular Weight | 451.78 g/mol |
| Exact Mass | 451.04 |
| IUPAC Name | [2-oxo-2-[3-(trifluoromethyl)anilino]ethyl] 2-chloro-5-(5-formylfuran-2-yl)benzoate |
| SMILES | O=Cc1ccc(-c2ccc(Cl)c(C(=O)OCC(=O)Nc3cccc(C(F)(F)F)c3)c2)o1 |
| InChI | InChI=1S/C21H13ClF3NO5/c22-17-6-4-12(18-7-5-15(10-27)31-18)8-16(17)20(29)30-11-19(28)26-14-3-1-2-13(9-14)21(23,24)25/h1-10H,11H2,(H,26,28) |
| InChIKey | LSNZTXLBPBMITE-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.78 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|