C17H16BrIN2O4 — CID 126195004
2-[2-bromo-6-[(Z)-2-cyano-3-(cyclopentylamino)-3-oxoprop-1-enyl]-4-iodophenoxy]acetic acid (PubChem CID 126195004) has the molecular formula C17H16BrIN2O4 and a molecular weight of 519.13 g/mol. Its IUPAC name is 2-[2-bromo-6-[(Z)-2-cyano-3-(cyclopentylamino)-3-oxoprop-1-enyl]-4-iodophenoxy]acetic acid.
| Compound Name | 2-[2-bromo-6-[(Z)-2-cyano-3-(cyclopentylamino)-3-oxoprop-1-enyl]-4-iodophenoxy]acetic acid |
|---|---|
| PubChem CID | 126195004 |
| Molecular Formula | C17H16BrIN2O4 |
| Molecular Weight | 519.13 g/mol |
| Exact Mass | 517.93 |
| IUPAC Name | 2-[2-bromo-6-[(Z)-2-cyano-3-(cyclopentylamino)-3-oxoprop-1-enyl]-4-iodophenoxy]acetic acid |
| SMILES | N#C/C(=C/c1cc(I)cc(Br)c1OCC(=O)O)C(=O)NC1CCCC1 |
| InChI | InChI=1S/C17H16BrIN2O4/c18-14-7-12(19)6-10(16(14)25-9-15(22)23)5-11(8-20)17(24)21-13-3-1-2-4-13/h5-7,13H,1-4,9H2,(H,21,24)(H,22,23)/b11-5- |
| InChIKey | AGOHUGHKQMFGGO-WZUFQYTHSA-N |
| XLogP | 3.48 |
| TPSA | 99.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.13 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|