C20H29N9O2 — CID 126341420
N-[(Z)-[2,4-bis[(2R)-2-methylpiperidin-1-yl]-5-nitrophenyl]methylideneamino]-2H-tetrazol-5-amine (PubChem CID 126341420) has the molecular formula C20H29N9O2 and a molecular weight of 427.51 g/mol. Its IUPAC name is N-[(Z)-[2,4-bis[(2R)-2-methylpiperidin-1-yl]-5-nitrophenyl]methylideneamino]-2H-tetrazol-5-amine.
| Compound Name | N-[(Z)-[2,4-bis[(2R)-2-methylpiperidin-1-yl]-5-nitrophenyl]methylideneamino]-2H-tetrazol-5-amine |
|---|---|
| PubChem CID | 126341420 |
| Molecular Formula | C20H29N9O2 |
| Molecular Weight | 427.51 g/mol |
| Exact Mass | 427.24 |
| IUPAC Name | N-[(Z)-[2,4-bis[(2R)-2-methylpiperidin-1-yl]-5-nitrophenyl]methylideneamino]-2H-tetrazol-5-amine |
| SMILES | C[C@@H]1CCCCN1c1cc(N2CCCC[C@H]2C)c([N+](=O)[O-])cc1/C=N\Nc1nn[nH]n1 |
| InChI | InChI=1S/C20H29N9O2/c1-14-7-3-5-9-27(14)17-12-18(28-10-6-4-8-15(28)2)19(29(30)31)11-16(17)13-21-22-20-23-25-26-24-20/h11-15H,3-10H2,1-2H3,(H2,22,23,24,25,26)/b21-13-/t14-,15-/m1/s1 |
| InChIKey | LBYWWIAYPJLGJE-DVVSODDZSA-N |
| XLogP | 3.31 |
| TPSA | 128.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.51 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|