C17H21F3N2O2S — CID 126364812
2-benzylsulfanyl-1-[(5S)-3-butyl-5-hydroxy-5-(trifluoromethyl)-4H-pyrazol-1-yl]ethanone (PubChem CID 126364812) has the molecular formula C17H21F3N2O2S and a molecular weight of 374.43 g/mol. Its IUPAC name is 2-benzylsulfanyl-1-[(5S)-3-butyl-5-hydroxy-5-(trifluoromethyl)-4H-pyrazol-1-yl]ethanone.
| Compound Name | 2-benzylsulfanyl-1-[(5S)-3-butyl-5-hydroxy-5-(trifluoromethyl)-4H-pyrazol-1-yl]ethanone |
|---|---|
| PubChem CID | 126364812 |
| Molecular Formula | C17H21F3N2O2S |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | 2-benzylsulfanyl-1-[(5S)-3-butyl-5-hydroxy-5-(trifluoromethyl)-4H-pyrazol-1-yl]ethanone |
| SMILES | CCCCC1=NN(C(=O)CSCc2ccccc2)[C@@](O)(C(F)(F)F)C1 |
| InChI | InChI=1S/C17H21F3N2O2S/c1-2-3-9-14-10-16(24,17(18,19)20)22(21-14)15(23)12-25-11-13-7-5-4-6-8-13/h4-8,24H,2-3,9-12H2,1H3/t16-/m0/s1 |
| InChIKey | NNNAZEJKJGBLAR-INIZCTEOSA-N |
| XLogP | 3.95 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |