C22H14Cl2N2O6S — CID 126381038
2-[(5Z)-5-[(6,8-dichloro-4-oxochromen-3-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-methoxyphenyl)acetamide (PubChem CID 126381038) has the molecular formula C22H14Cl2N2O6S and a molecular weight of 505.34 g/mol. Its IUPAC name is 2-[(5Z)-5-[(6,8-dichloro-4-oxochromen-3-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-methoxyphenyl)acetamide.
| Compound Name | 2-[(5Z)-5-[(6,8-dichloro-4-oxochromen-3-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 126381038 |
| Molecular Formula | C22H14Cl2N2O6S |
| Molecular Weight | 505.34 g/mol |
| Exact Mass | 503.99 |
| IUPAC Name | 2-[(5Z)-5-[(6,8-dichloro-4-oxochromen-3-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-methoxyphenyl)acetamide |
| SMILES | COc1ccccc1NC(=O)CN1C(=O)S/C(=C\c2coc3c(Cl)cc(Cl)cc3c2=O)C1=O |
| InChI | InChI=1S/C22H14Cl2N2O6S/c1-31-16-5-3-2-4-15(16)25-18(27)9-26-21(29)17(33-22(26)30)6-11-10-32-20-13(19(11)28)7-12(23)8-14(20)24/h2-8,10H,9H2,1H3,(H,25,27)/b17-6- |
| InChIKey | YFMYGGOCSAOVHU-FMQZQXMHSA-N |
| XLogP | 4.78 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.34 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|