C20H10Cl2FNO4S — CID 126384954
(5Z)-5-[(6,8-dichloro-4-oxochromen-3-yl)methylidene]-3-[(4-fluorophenyl)methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 126384954) has the molecular formula C20H10Cl2FNO4S and a molecular weight of 450.27 g/mol. Its IUPAC name is (5Z)-5-[(6,8-dichloro-4-oxochromen-3-yl)methylidene]-3-[(4-fluorophenyl)methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[(6,8-dichloro-4-oxochromen-3-yl)methylidene]-3-[(4-fluorophenyl)methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126384954 |
| Molecular Formula | C20H10Cl2FNO4S |
| Molecular Weight | 450.27 g/mol |
| Exact Mass | 448.97 |
| IUPAC Name | (5Z)-5-[(6,8-dichloro-4-oxochromen-3-yl)methylidene]-3-[(4-fluorophenyl)methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1S/C(=C\c2coc3c(Cl)cc(Cl)cc3c2=O)C(=O)N1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C20H10Cl2FNO4S/c21-12-6-14-17(25)11(9-28-18(14)15(22)7-12)5-16-19(26)24(20(27)29-16)8-10-1-3-13(23)4-2-10/h1-7,9H,8H2/b16-5- |
| InChIKey | LYGNDDXHWRJNFY-BNCCVWRVSA-N |
| XLogP | 5.48 |
| TPSA | 67.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.27 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|