C20H9Cl3FNO4S — CID 126387033
(5Z)-3-[(2-chloro-4-fluorophenyl)methyl]-5-[(6,8-dichloro-4-oxochromen-3-yl)methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 126387033) has the molecular formula C20H9Cl3FNO4S and a molecular weight of 484.72 g/mol. Its IUPAC name is (5Z)-3-[(2-chloro-4-fluorophenyl)methyl]-5-[(6,8-dichloro-4-oxochromen-3-yl)methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-3-[(2-chloro-4-fluorophenyl)methyl]-5-[(6,8-dichloro-4-oxochromen-3-yl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126387033 |
| Molecular Formula | C20H9Cl3FNO4S |
| Molecular Weight | 484.72 g/mol |
| Exact Mass | 482.93 |
| IUPAC Name | (5Z)-3-[(2-chloro-4-fluorophenyl)methyl]-5-[(6,8-dichloro-4-oxochromen-3-yl)methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1S/C(=C\c2coc3c(Cl)cc(Cl)cc3c2=O)C(=O)N1Cc1ccc(F)cc1Cl |
| InChI | InChI=1S/C20H9Cl3FNO4S/c21-11-4-13-17(26)10(8-29-18(13)15(23)5-11)3-16-19(27)25(20(28)30-16)7-9-1-2-12(24)6-14(9)22/h1-6,8H,7H2/b16-3- |
| InChIKey | MZKHNBQQSGQCGB-XFQLMFQHSA-N |
| XLogP | 6.13 |
| TPSA | 67.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.72 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|