C22H13Cl3N2O5S — CID 126383730
N-(3-chloro-4-methylphenyl)-2-[(5Z)-5-[(6,8-dichloro-4-oxochromen-3-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide (PubChem CID 126383730) has the molecular formula C22H13Cl3N2O5S and a molecular weight of 523.78 g/mol. Its IUPAC name is N-(3-chloro-4-methylphenyl)-2-[(5Z)-5-[(6,8-dichloro-4-oxochromen-3-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide.
| Compound Name | N-(3-chloro-4-methylphenyl)-2-[(5Z)-5-[(6,8-dichloro-4-oxochromen-3-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 126383730 |
| Molecular Formula | C22H13Cl3N2O5S |
| Molecular Weight | 523.78 g/mol |
| Exact Mass | 521.96 |
| IUPAC Name | N-(3-chloro-4-methylphenyl)-2-[(5Z)-5-[(6,8-dichloro-4-oxochromen-3-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
| SMILES | Cc1ccc(NC(=O)CN2C(=O)S/C(=C\c3coc4c(Cl)cc(Cl)cc4c3=O)C2=O)cc1Cl |
| InChI | InChI=1S/C22H13Cl3N2O5S/c1-10-2-3-13(7-15(10)24)26-18(28)8-27-21(30)17(33-22(27)31)4-11-9-32-20-14(19(11)29)5-12(23)6-16(20)25/h2-7,9H,8H2,1H3,(H,26,28)/b17-4- |
| InChIKey | UVPQWGNUWIMFLI-INGKJJEOSA-N |
| XLogP | 5.74 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.78 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|