C26H19Cl3N2O7S — CID 126381612
butyl 2-chloro-5-[[2-[(5Z)-5-[(6,8-dichloro-4-oxochromen-3-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate (PubChem CID 126381612) has the molecular formula C26H19Cl3N2O7S and a molecular weight of 609.87 g/mol. Its IUPAC name is butyl 2-chloro-5-[[2-[(5Z)-5-[(6,8-dichloro-4-oxochromen-3-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate.
| Compound Name | butyl 2-chloro-5-[[2-[(5Z)-5-[(6,8-dichloro-4-oxochromen-3-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 126381612 |
| Molecular Formula | C26H19Cl3N2O7S |
| Molecular Weight | 609.87 g/mol |
| Exact Mass | 608.00 |
| IUPAC Name | butyl 2-chloro-5-[[2-[(5Z)-5-[(6,8-dichloro-4-oxochromen-3-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1cc(NC(=O)CN2C(=O)S/C(=C\c3coc4c(Cl)cc(Cl)cc4c3=O)C2=O)ccc1Cl |
| InChI | InChI=1S/C26H19Cl3N2O7S/c1-2-3-6-37-25(35)16-10-15(4-5-18(16)28)30-21(32)11-31-24(34)20(39-26(31)36)7-13-12-38-23-17(22(13)33)8-14(27)9-19(23)29/h4-5,7-10,12H,2-3,6,11H2,1H3,(H,30,32)/b20-7- |
| InChIKey | FIUUTJFDSKYUTA-SCDVKCJHSA-N |
| XLogP | 6.39 |
| TPSA | 122.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.87 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|