C21H11Cl2IN2O5S — CID 126384467
2-[(5Z)-5-[(6,8-dichloro-4-oxochromen-3-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-iodophenyl)acetamide (PubChem CID 126384467) has the molecular formula C21H11Cl2IN2O5S and a molecular weight of 601.21 g/mol. Its IUPAC name is 2-[(5Z)-5-[(6,8-dichloro-4-oxochromen-3-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-iodophenyl)acetamide.
| Compound Name | 2-[(5Z)-5-[(6,8-dichloro-4-oxochromen-3-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-iodophenyl)acetamide |
|---|---|
| PubChem CID | 126384467 |
| Molecular Formula | C21H11Cl2IN2O5S |
| Molecular Weight | 601.21 g/mol |
| Exact Mass | 599.88 |
| IUPAC Name | 2-[(5Z)-5-[(6,8-dichloro-4-oxochromen-3-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-iodophenyl)acetamide |
| SMILES | O=C(CN1C(=O)S/C(=C\c2coc3c(Cl)cc(Cl)cc3c2=O)C1=O)Nc1ccc(I)cc1 |
| InChI | InChI=1S/C21H11Cl2IN2O5S/c22-11-6-14-18(28)10(9-31-19(14)15(23)7-11)5-16-20(29)26(21(30)32-16)8-17(27)25-13-3-1-12(24)2-4-13/h1-7,9H,8H2,(H,25,27)/b16-5- |
| InChIKey | AXTNENSOWMHCJG-BNCCVWRVSA-N |
| XLogP | 5.38 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.21 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|