C26H22NOP — CID 126419240
N-[4-(triphenyl-λ5-phosphanylidene)cyclohexa-2,5-dien-1-ylidene]acetamide (PubChem CID 126419240) has the molecular formula C26H22NOP and a molecular weight of 395.44 g/mol. Its IUPAC name is N-[4-(triphenyl-λ5-phosphanylidene)cyclohexa-2,5-dien-1-ylidene]acetamide.
| Compound Name | N-[4-(triphenyl-λ5-phosphanylidene)cyclohexa-2,5-dien-1-ylidene]acetamide |
|---|---|
| PubChem CID | 126419240 |
| Molecular Formula | C26H22NOP |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | N-[4-(triphenyl-λ5-phosphanylidene)cyclohexa-2,5-dien-1-ylidene]acetamide |
| SMILES | CC(=O)N=C1C=CC(=P(c2ccccc2)(c2ccccc2)c2ccccc2)C=C1 |
| InChI | InChI=1S/C26H22NOP/c1-21(28)27-22-17-19-26(20-18-22)29(23-11-5-2-6-12-23,24-13-7-3-8-14-24)25-15-9-4-10-16-25/h2-20H,1H3 |
| InChIKey | CLEPJFBETGZMQI-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|