C28H18N3P — CID 139090481
2-[3-(triphenyl-λ5-phosphanylidene)cyclopenta-1,4-dien-1-yl]ethene-1,1,2-tricarbonitrile (PubChem CID 139090481) has the molecular formula C28H18N3P and a molecular weight of 427.45 g/mol. Its IUPAC name is 2-[3-(triphenyl-λ5-phosphanylidene)cyclopenta-1,4-dien-1-yl]ethene-1,1,2-tricarbonitrile.
| Compound Name | 2-[3-(triphenyl-λ5-phosphanylidene)cyclopenta-1,4-dien-1-yl]ethene-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 139090481 |
| Molecular Formula | C28H18N3P |
| Molecular Weight | 427.45 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | 2-[3-(triphenyl-λ5-phosphanylidene)cyclopenta-1,4-dien-1-yl]ethene-1,1,2-tricarbonitrile |
| SMILES | N#CC(C#N)=C(C#N)C1=CC(=P(c2ccccc2)(c2ccccc2)c2ccccc2)C=C1 |
| InChI | InChI=1S/C28H18N3P/c29-19-23(20-30)28(21-31)22-16-17-27(18-22)32(24-10-4-1-5-11-24,25-12-6-2-7-13-25)26-14-8-3-9-15-26/h1-18H |
| InChIKey | CBAUDYKEEYEBRM-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 71.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.45 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|