C7H7N3O — CID 126421907
5H-pyrrolo[2,3-d]pyrimidin-4-ylmethanol (PubChem CID 126421907) has the molecular formula C7H7N3O and a molecular weight of 149.15 g/mol. Its IUPAC name is 5H-pyrrolo[2,3-d]pyrimidin-4-ylmethanol.
| Compound Name | 5H-pyrrolo[2,3-d]pyrimidin-4-ylmethanol |
|---|---|
| PubChem CID | 126421907 |
| Molecular Formula | C7H7N3O |
| Molecular Weight | 149.15 g/mol |
| Exact Mass | 149.06 |
| IUPAC Name | 5H-pyrrolo[2,3-d]pyrimidin-4-ylmethanol |
| SMILES | OCc1ncnc2c1CC=N2 |
| InChI | InChI=1S/C7H7N3O/c11-3-6-5-1-2-8-7(5)10-4-9-6/h2,4,11H,1,3H2 |
| InChIKey | QGFPIVXFGHNTAX-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.15 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |