C20H18N4O3S — CID 126458339
N-benzyl-2-(8-methoxy-4-oxo-2-sulfanylidene-1,5-dihydropyrimido[5,4-b]indol-3-yl)acetamide (PubChem CID 126458339) has the molecular formula C20H18N4O3S and a molecular weight of 394.46 g/mol. Its IUPAC name is N-benzyl-2-(8-methoxy-4-oxo-2-sulfanylidene-1,5-dihydropyrimido[5,4-b]indol-3-yl)acetamide.
| Compound Name | N-benzyl-2-(8-methoxy-4-oxo-2-sulfanylidene-1,5-dihydropyrimido[5,4-b]indol-3-yl)acetamide |
|---|---|
| PubChem CID | 126458339 |
| Molecular Formula | C20H18N4O3S |
| Molecular Weight | 394.46 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | N-benzyl-2-(8-methoxy-4-oxo-2-sulfanylidene-1,5-dihydropyrimido[5,4-b]indol-3-yl)acetamide |
| SMILES | COc1ccc2[nH]c3c(=O)n(CC(=O)NCc4ccccc4)c(=S)[nH]c3c2c1 |
| InChI | InChI=1S/C20H18N4O3S/c1-27-13-7-8-15-14(9-13)17-18(22-15)19(26)24(20(28)23-17)11-16(25)21-10-12-5-3-2-4-6-12/h2-9,22H,10-11H2,1H3,(H,21,25)(H,23,28) |
| InChIKey | OYQTWLPTXPDJKY-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 91.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.46 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|