C24H26N4O3S — CID 46258025
N-(3,5-dimethylphenyl)-5-(8-methoxy-4-oxo-2-sulfanylidene-1,5-dihydropyrimido[5,4-b]indol-3-yl)pentanamide (PubChem CID 46258025) has the molecular formula C24H26N4O3S and a molecular weight of 450.56 g/mol. Its IUPAC name is N-(3,5-dimethylphenyl)-5-(8-methoxy-4-oxo-2-sulfanylidene-1,5-dihydropyrimido[5,4-b]indol-3-yl)pentanamide.
| Compound Name | N-(3,5-dimethylphenyl)-5-(8-methoxy-4-oxo-2-sulfanylidene-1,5-dihydropyrimido[5,4-b]indol-3-yl)pentanamide |
|---|---|
| PubChem CID | 46258025 |
| Molecular Formula | C24H26N4O3S |
| Molecular Weight | 450.56 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | N-(3,5-dimethylphenyl)-5-(8-methoxy-4-oxo-2-sulfanylidene-1,5-dihydropyrimido[5,4-b]indol-3-yl)pentanamide |
| SMILES | COc1ccc2[nH]c3c(=O)n(CCCCC(=O)Nc4cc(C)cc(C)c4)c(=S)[nH]c3c2c1 |
| InChI | InChI=1S/C24H26N4O3S/c1-14-10-15(2)12-16(11-14)25-20(29)6-4-5-9-28-23(30)22-21(27-24(28)32)18-13-17(31-3)7-8-19(18)26-22/h7-8,10-13,26H,4-6,9H2,1-3H3,(H,25,29)(H,27,32) |
| InChIKey | TWHDIUZVCIGRHU-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 91.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.56 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|