C26H28N4O3S — CID 92666890
5-(8-methoxy-4-oxo-2-sulfanylidene-1,5-dihydropyrimido[5,4-b]indol-3-yl)-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]pentanamide (PubChem CID 92666890) has the molecular formula C26H28N4O3S and a molecular weight of 476.60 g/mol. Its IUPAC name is 5-(8-methoxy-4-oxo-2-sulfanylidene-1,5-dihydropyrimido[5,4-b]indol-3-yl)-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]pentanamide.
| Compound Name | 5-(8-methoxy-4-oxo-2-sulfanylidene-1,5-dihydropyrimido[5,4-b]indol-3-yl)-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]pentanamide |
|---|---|
| PubChem CID | 92666890 |
| Molecular Formula | C26H28N4O3S |
| Molecular Weight | 476.60 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | 5-(8-methoxy-4-oxo-2-sulfanylidene-1,5-dihydropyrimido[5,4-b]indol-3-yl)-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]pentanamide |
| SMILES | COc1ccc2[nH]c3c(=O)n(CCCCC(=O)N[C@H]4CCCc5ccccc54)c(=S)[nH]c3c2c1 |
| InChI | InChI=1S/C26H28N4O3S/c1-33-17-12-13-21-19(15-17)23-24(28-21)25(32)30(26(34)29-23)14-5-4-11-22(31)27-20-10-6-8-16-7-2-3-9-18(16)20/h2-3,7,9,12-13,15,20,28H,4-6,8,10-11,14H2,1H3,(H,27,31)(H,29,34)/t20-/m0/s1 |
| InChIKey | NSAUOYYLSGBCAV-FQEVSTJZSA-N |
| XLogP | 4.91 |
| TPSA | 91.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.60 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|