C23H30N4O3S — CID 46257701
8-methoxy-3-[6-(3-methylpiperidin-1-yl)-6-oxohexyl]-2-sulfanylidene-1,5-dihydropyrimido[5,4-b]indol-4-one (PubChem CID 46257701) has the molecular formula C23H30N4O3S and a molecular weight of 442.59 g/mol. Its IUPAC name is 8-methoxy-3-[6-(3-methylpiperidin-1-yl)-6-oxohexyl]-2-sulfanylidene-1,5-dihydropyrimido[5,4-b]indol-4-one.
| Compound Name | 8-methoxy-3-[6-(3-methylpiperidin-1-yl)-6-oxohexyl]-2-sulfanylidene-1,5-dihydropyrimido[5,4-b]indol-4-one |
|---|---|
| PubChem CID | 46257701 |
| Molecular Formula | C23H30N4O3S |
| Molecular Weight | 442.59 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | 8-methoxy-3-[6-(3-methylpiperidin-1-yl)-6-oxohexyl]-2-sulfanylidene-1,5-dihydropyrimido[5,4-b]indol-4-one |
| SMILES | COc1ccc2[nH]c3c(=O)n(CCCCCC(=O)N4CCCC(C)C4)c(=S)[nH]c3c2c1 |
| InChI | InChI=1S/C23H30N4O3S/c1-15-7-6-11-26(14-15)19(28)8-4-3-5-12-27-22(29)21-20(25-23(27)31)17-13-16(30-2)9-10-18(17)24-21/h9-10,13,15,24H,3-8,11-12,14H2,1-2H3,(H,25,31) |
| InChIKey | FIVMVPKADUOXRH-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.59 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|