C23H21F3N4O3S — CID 46258021
5-(8-methoxy-4-oxo-2-sulfanylidene-1,5-dihydropyrimido[5,4-b]indol-3-yl)-N-[3-(trifluoromethyl)phenyl]pentanamide (PubChem CID 46258021) has the molecular formula C23H21F3N4O3S and a molecular weight of 490.51 g/mol. Its IUPAC name is 5-(8-methoxy-4-oxo-2-sulfanylidene-1,5-dihydropyrimido[5,4-b]indol-3-yl)-N-[3-(trifluoromethyl)phenyl]pentanamide.
| Compound Name | 5-(8-methoxy-4-oxo-2-sulfanylidene-1,5-dihydropyrimido[5,4-b]indol-3-yl)-N-[3-(trifluoromethyl)phenyl]pentanamide |
|---|---|
| PubChem CID | 46258021 |
| Molecular Formula | C23H21F3N4O3S |
| Molecular Weight | 490.51 g/mol |
| Exact Mass | 490.13 |
| IUPAC Name | 5-(8-methoxy-4-oxo-2-sulfanylidene-1,5-dihydropyrimido[5,4-b]indol-3-yl)-N-[3-(trifluoromethyl)phenyl]pentanamide |
| SMILES | COc1ccc2[nH]c3c(=O)n(CCCCC(=O)Nc4cccc(C(F)(F)F)c4)c(=S)[nH]c3c2c1 |
| InChI | InChI=1S/C23H21F3N4O3S/c1-33-15-8-9-17-16(12-15)19-20(28-17)21(32)30(22(34)29-19)10-3-2-7-18(31)27-14-6-4-5-13(11-14)23(24,25)26/h4-6,8-9,11-12,28H,2-3,7,10H2,1H3,(H,27,31)(H,29,34) |
| InChIKey | YNDMBMSBKUSAIT-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 91.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.51 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|