C22H21ClN4O3S — CID 46257878
N-[(4-chlorophenyl)methyl]-4-(8-methoxy-4-oxo-2-sulfanylidene-1,5-dihydropyrimido[5,4-b]indol-3-yl)butanamide (PubChem CID 46257878) has the molecular formula C22H21ClN4O3S and a molecular weight of 456.96 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-4-(8-methoxy-4-oxo-2-sulfanylidene-1,5-dihydropyrimido[5,4-b]indol-3-yl)butanamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-4-(8-methoxy-4-oxo-2-sulfanylidene-1,5-dihydropyrimido[5,4-b]indol-3-yl)butanamide |
|---|---|
| PubChem CID | 46257878 |
| Molecular Formula | C22H21ClN4O3S |
| Molecular Weight | 456.96 g/mol |
| Exact Mass | 456.10 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-4-(8-methoxy-4-oxo-2-sulfanylidene-1,5-dihydropyrimido[5,4-b]indol-3-yl)butanamide |
| SMILES | COc1ccc2[nH]c3c(=O)n(CCCC(=O)NCc4ccc(Cl)cc4)c(=S)[nH]c3c2c1 |
| InChI | InChI=1S/C22H21ClN4O3S/c1-30-15-8-9-17-16(11-15)19-20(25-17)21(29)27(22(31)26-19)10-2-3-18(28)24-12-13-4-6-14(23)7-5-13/h4-9,11,25H,2-3,10,12H2,1H3,(H,24,28)(H,26,31) |
| InChIKey | FDRTZCUYHOKYMD-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 91.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.96 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|