C27H34N4O3S — CID 92666839
N-[(1S)-1-(1-adamantyl)ethyl]-4-(8-methoxy-4-oxo-2-sulfanylidene-1,5-dihydropyrimido[5,4-b]indol-3-yl)butanamide (PubChem CID 92666839) has the molecular formula C27H34N4O3S and a molecular weight of 494.66 g/mol. Its IUPAC name is N-[(1S)-1-(1-adamantyl)ethyl]-4-(8-methoxy-4-oxo-2-sulfanylidene-1,5-dihydropyrimido[5,4-b]indol-3-yl)butanamide.
| Compound Name | N-[(1S)-1-(1-adamantyl)ethyl]-4-(8-methoxy-4-oxo-2-sulfanylidene-1,5-dihydropyrimido[5,4-b]indol-3-yl)butanamide |
|---|---|
| PubChem CID | 92666839 |
| Molecular Formula | C27H34N4O3S |
| Molecular Weight | 494.66 g/mol |
| Exact Mass | 494.24 |
| IUPAC Name | N-[(1S)-1-(1-adamantyl)ethyl]-4-(8-methoxy-4-oxo-2-sulfanylidene-1,5-dihydropyrimido[5,4-b]indol-3-yl)butanamide |
| SMILES | COc1ccc2[nH]c3c(=O)n(CCCC(=O)N[C@@H](C)C45CC6CC(CC(C6)C4)C5)c(=S)[nH]c3c2c1 |
| InChI | InChI=1S/C27H34N4O3S/c1-15(27-12-16-8-17(13-27)10-18(9-16)14-27)28-22(32)4-3-7-31-25(33)24-23(30-26(31)35)20-11-19(34-2)5-6-21(20)29-24/h5-6,11,15-18,29H,3-4,7-10,12-14H2,1-2H3,(H,28,32)(H,30,35)/t15-,16?,17?,18?,27?/m0/s1 |
| InChIKey | QSBBXNHNGNYLLI-GLCHGYBISA-N |
| XLogP | 5.05 |
| TPSA | 91.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.66 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|