C23H32N4O4S — CID 46257694
6-(8-methoxy-4-oxo-2-sulfanylidene-1,5-dihydropyrimido[5,4-b]indol-3-yl)-N-(3-propan-2-yloxypropyl)hexanamide (PubChem CID 46257694) has the molecular formula C23H32N4O4S and a molecular weight of 460.60 g/mol. Its IUPAC name is 6-(8-methoxy-4-oxo-2-sulfanylidene-1,5-dihydropyrimido[5,4-b]indol-3-yl)-N-(3-propan-2-yloxypropyl)hexanamide.
| Compound Name | 6-(8-methoxy-4-oxo-2-sulfanylidene-1,5-dihydropyrimido[5,4-b]indol-3-yl)-N-(3-propan-2-yloxypropyl)hexanamide |
|---|---|
| PubChem CID | 46257694 |
| Molecular Formula | C23H32N4O4S |
| Molecular Weight | 460.60 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | 6-(8-methoxy-4-oxo-2-sulfanylidene-1,5-dihydropyrimido[5,4-b]indol-3-yl)-N-(3-propan-2-yloxypropyl)hexanamide |
| SMILES | COc1ccc2[nH]c3c(=O)n(CCCCCC(=O)NCCCOC(C)C)c(=S)[nH]c3c2c1 |
| InChI | InChI=1S/C23H32N4O4S/c1-15(2)31-13-7-11-24-19(28)8-5-4-6-12-27-22(29)21-20(26-23(27)32)17-14-16(30-3)9-10-18(17)25-21/h9-10,14-15,25H,4-8,11-13H2,1-3H3,(H,24,28)(H,26,32) |
| InChIKey | LMBPRQLHJCTOHF-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 101.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.60 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|