C26H30N4O3S — CID 92666888
5-(8-methoxy-4-oxo-2-sulfanylidene-1,5-dihydropyrimido[5,4-b]indol-3-yl)-N-[(2R)-4-phenylbutan-2-yl]pentanamide (PubChem CID 92666888) has the molecular formula C26H30N4O3S and a molecular weight of 478.62 g/mol. Its IUPAC name is 5-(8-methoxy-4-oxo-2-sulfanylidene-1,5-dihydropyrimido[5,4-b]indol-3-yl)-N-[(2R)-4-phenylbutan-2-yl]pentanamide.
| Compound Name | 5-(8-methoxy-4-oxo-2-sulfanylidene-1,5-dihydropyrimido[5,4-b]indol-3-yl)-N-[(2R)-4-phenylbutan-2-yl]pentanamide |
|---|---|
| PubChem CID | 92666888 |
| Molecular Formula | C26H30N4O3S |
| Molecular Weight | 478.62 g/mol |
| Exact Mass | 478.20 |
| IUPAC Name | 5-(8-methoxy-4-oxo-2-sulfanylidene-1,5-dihydropyrimido[5,4-b]indol-3-yl)-N-[(2R)-4-phenylbutan-2-yl]pentanamide |
| SMILES | COc1ccc2[nH]c3c(=O)n(CCCCC(=O)N[C@H](C)CCc4ccccc4)c(=S)[nH]c3c2c1 |
| InChI | InChI=1S/C26H30N4O3S/c1-17(11-12-18-8-4-3-5-9-18)27-22(31)10-6-7-15-30-25(32)24-23(29-26(30)34)20-16-19(33-2)13-14-21(20)28-24/h3-5,8-9,13-14,16-17,28H,6-7,10-12,15H2,1-2H3,(H,27,31)(H,29,34)/t17-/m1/s1 |
| InChIKey | OVIXORZEOKWERS-QGZVFWFLSA-N |
| XLogP | 4.86 |
| TPSA | 91.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.62 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|