C22H28N4O3S — CID 46258078
8-methoxy-3-[5-(3-methylpiperidin-1-yl)-5-oxopentyl]-2-sulfanylidene-1,5-dihydropyrimido[5,4-b]indol-4-one (PubChem CID 46258078) has the molecular formula C22H28N4O3S and a molecular weight of 428.56 g/mol. Its IUPAC name is 8-methoxy-3-[5-(3-methylpiperidin-1-yl)-5-oxopentyl]-2-sulfanylidene-1,5-dihydropyrimido[5,4-b]indol-4-one.
| Compound Name | 8-methoxy-3-[5-(3-methylpiperidin-1-yl)-5-oxopentyl]-2-sulfanylidene-1,5-dihydropyrimido[5,4-b]indol-4-one |
|---|---|
| PubChem CID | 46258078 |
| Molecular Formula | C22H28N4O3S |
| Molecular Weight | 428.56 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | 8-methoxy-3-[5-(3-methylpiperidin-1-yl)-5-oxopentyl]-2-sulfanylidene-1,5-dihydropyrimido[5,4-b]indol-4-one |
| SMILES | COc1ccc2[nH]c3c(=O)n(CCCCC(=O)N4CCCC(C)C4)c(=S)[nH]c3c2c1 |
| InChI | InChI=1S/C22H28N4O3S/c1-14-6-5-10-25(13-14)18(27)7-3-4-11-26-21(28)20-19(24-22(26)30)16-12-15(29-2)8-9-17(16)23-20/h8-9,12,14,23H,3-7,10-11,13H2,1-2H3,(H,24,30) |
| InChIKey | KUIIUGWHCGOQOL-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.56 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|