C18H27N3O5S2 — CID 126459153
1-(4-methylsulfonylphenyl)sulfonyl-4-piperidin-1-ylpiperidine-4-carboxamide (PubChem CID 126459153) has the molecular formula C18H27N3O5S2 and a molecular weight of 429.56 g/mol. Its IUPAC name is 1-(4-methylsulfonylphenyl)sulfonyl-4-piperidin-1-ylpiperidine-4-carboxamide.
| Compound Name | 1-(4-methylsulfonylphenyl)sulfonyl-4-piperidin-1-ylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 126459153 |
| Molecular Formula | C18H27N3O5S2 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | 1-(4-methylsulfonylphenyl)sulfonyl-4-piperidin-1-ylpiperidine-4-carboxamide |
| SMILES | CS(=O)(=O)c1ccc(S(=O)(=O)N2CCC(C(N)=O)(N3CCCCC3)CC2)cc1 |
| InChI | InChI=1S/C18H27N3O5S2/c1-27(23,24)15-5-7-16(8-6-15)28(25,26)21-13-9-18(10-14-21,17(19)22)20-11-3-2-4-12-20/h5-8H,2-4,9-14H2,1H3,(H2,19,22) |
| InChIKey | RDUWFPLQJUJFLL-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 117.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |