C15H14BrN5O — CID 126497606
5-bromo-9-(methoxymethyl)-15-methyl-2,4,8,10,11-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,9,11,14,16-heptaene (PubChem CID 126497606) has the molecular formula C15H14BrN5O and a molecular weight of 360.22 g/mol. Its IUPAC name is 5-bromo-9-(methoxymethyl)-15-methyl-2,4,8,10,11-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,9,11,14,16-heptaene.
| Compound Name | 5-bromo-9-(methoxymethyl)-15-methyl-2,4,8,10,11-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,9,11,14,16-heptaene |
|---|---|
| PubChem CID | 126497606 |
| Molecular Formula | C15H14BrN5O |
| Molecular Weight | 360.22 g/mol |
| Exact Mass | 359.04 |
| IUPAC Name | 5-bromo-9-(methoxymethyl)-15-methyl-2,4,8,10,11-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,9,11,14,16-heptaene |
| SMILES | COCc1nnc2n1Cc1c(Br)ncn1-c1ccc(C)cc1-2 |
| InChI | InChI=1S/C15H14BrN5O/c1-9-3-4-11-10(5-9)15-19-18-13(7-22-2)20(15)6-12-14(16)17-8-21(11)12/h3-5,8H,6-7H2,1-2H3 |
| InChIKey | MKZMWPHJSKDMDS-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 57.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.22 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |