C21H19N7O2 — CID 146366750
15-methoxy-9-(methoxymethyl)-5-[2-(2-methyl-1H-imidazol-5-yl)ethynyl]-2,4,8,10,11-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,9,11,14,16-heptaene (PubChem CID 146366750) has the molecular formula C21H19N7O2 and a molecular weight of 401.43 g/mol. Its IUPAC name is 15-methoxy-9-(methoxymethyl)-5-[2-(2-methyl-1H-imidazol-5-yl)ethynyl]-2,4,8,10,11-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,9,11,14,16-heptaene.
| Compound Name | 15-methoxy-9-(methoxymethyl)-5-[2-(2-methyl-1H-imidazol-5-yl)ethynyl]-2,4,8,10,11-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,9,11,14,16-heptaene |
|---|---|
| PubChem CID | 146366750 |
| Molecular Formula | C21H19N7O2 |
| Molecular Weight | 401.43 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | 15-methoxy-9-(methoxymethyl)-5-[2-(2-methyl-1H-imidazol-5-yl)ethynyl]-2,4,8,10,11-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,9,11,14,16-heptaene |
| SMILES | COCc1nnc2n1Cc1c(C#Cc3cnc(C)[nH]3)ncn1-c1ccc(OC)cc1-2 |
| InChI | InChI=1S/C21H19N7O2/c1-13-22-9-14(24-13)4-6-17-19-10-27-20(11-29-2)25-26-21(27)16-8-15(30-3)5-7-18(16)28(19)12-23-17/h5,7-9,12H,10-11H2,1-3H3,(H,22,24) |
| InChIKey | ALTPKIYMUSMMSJ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 95.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.43 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|