C26H26N6O2 — CID 146366952
5-[2-(5-tert-butyl-2-pyridinyl)ethynyl]-15-methoxy-9-(methoxymethyl)-2,4,8,10,11-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,9,11,14,16-heptaene (PubChem CID 146366952) has the molecular formula C26H26N6O2 and a molecular weight of 454.53 g/mol. Its IUPAC name is 5-[2-(5-tert-butyl-2-pyridinyl)ethynyl]-15-methoxy-9-(methoxymethyl)-2,4,8,10,11-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,9,11,14,16-heptaene.
| Compound Name | 5-[2-(5-tert-butyl-2-pyridinyl)ethynyl]-15-methoxy-9-(methoxymethyl)-2,4,8,10,11-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,9,11,14,16-heptaene |
|---|---|
| PubChem CID | 146366952 |
| Molecular Formula | C26H26N6O2 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.21 |
| IUPAC Name | 5-[2-(5-tert-butyl-2-pyridinyl)ethynyl]-15-methoxy-9-(methoxymethyl)-2,4,8,10,11-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,9,11,14,16-heptaene |
| SMILES | COCc1nnc2n1Cc1c(C#Cc3ccc(C(C)(C)C)cn3)ncn1-c1ccc(OC)cc1-2 |
| InChI | InChI=1S/C26H26N6O2/c1-26(2,3)17-6-7-18(27-13-17)8-10-21-23-14-31-24(15-33-4)29-30-25(31)20-12-19(34-5)9-11-22(20)32(23)16-28-21/h6-7,9,11-13,16H,14-15H2,1-5H3 |
| InChIKey | MHZDZIMTLVYNAV-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 79.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|