C22H17ClN6O — CID 146366715
15-chloro-9-(methoxymethyl)-5-[2-(5-methyl-2-pyridinyl)ethynyl]-2,4,8,10,11-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,9,11,14,16-heptaene (PubChem CID 146366715) has the molecular formula C22H17ClN6O and a molecular weight of 416.87 g/mol. Its IUPAC name is 15-chloro-9-(methoxymethyl)-5-[2-(5-methyl-2-pyridinyl)ethynyl]-2,4,8,10,11-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,9,11,14,16-heptaene.
| Compound Name | 15-chloro-9-(methoxymethyl)-5-[2-(5-methyl-2-pyridinyl)ethynyl]-2,4,8,10,11-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,9,11,14,16-heptaene |
|---|---|
| PubChem CID | 146366715 |
| Molecular Formula | C22H17ClN6O |
| Molecular Weight | 416.87 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | 15-chloro-9-(methoxymethyl)-5-[2-(5-methyl-2-pyridinyl)ethynyl]-2,4,8,10,11-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,9,11,14,16-heptaene |
| SMILES | COCc1nnc2n1Cc1c(C#Cc3ccc(C)cn3)ncn1-c1ccc(Cl)cc1-2 |
| InChI | InChI=1S/C22H17ClN6O/c1-14-3-5-16(24-10-14)6-7-18-20-11-28-21(12-30-2)26-27-22(28)17-9-15(23)4-8-19(17)29(20)13-25-18/h3-5,8-10,13H,11-12H2,1-2H3 |
| InChIKey | WOZOBONZYQXDGW-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 70.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.87 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|