About 8-methyl-5,6,8-triazadispiro[2.0.24.33]nonane
8-methyl-5,6,8-triazadispiro[2.0.24.33]nonane (PubChem CID 126563217) has the molecular formula C7H13N3
and a molecular weight of 139.20 g/mol. Its IUPAC name is 8-methyl-5,6,8-triazadispiro[2.0.24.33]nonane.
Molecular Properties
| Compound Name | 8-methyl-5,6,8-triazadispiro[2.0.24.33]nonane |
| PubChem CID | 126563217 |
| Molecular Formula | C7H13N3 |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.11 |
| IUPAC Name | 8-methyl-5,6,8-triazadispiro[2.0.24.33]nonane |
| SMILES | CN1CC2(CC2)C2(C1)NN2 |
| InChI | InChI=1S/C7H13N3/c1-10-4-6(2-3-6)7(5-10)8-9-7/h8-9H,2-5H2,1H3 |
| InChIKey | NQUNRKKJILJNPL-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 47.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 8-methyl-5,6,8-triazadispiro[2.0.24.33]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methyl-5,6,8-triazadispiro[2.0.24.33]nonane?
The IUPAC name of 8-methyl-5,6,8-triazadispiro[2.0.24.33]nonane (CID 126563217) is 8-methyl-5,6,8-triazadispiro[2.0.24.33]nonane.
What is the SMILES notation for 8-methyl-5,6,8-triazadispiro[2.0.24.33]nonane?
The canonical SMILES for 8-methyl-5,6,8-triazadispiro[2.0.24.33]nonane is CN1CC2(CC2)C2(C1)NN2.
What is the InChIKey of 8-methyl-5,6,8-triazadispiro[2.0.24.33]nonane?
The InChIKey is NQUNRKKJILJNPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N3/c1-10-4-6(2-3-6)7(5-10)8-9-7/h8-9H,2-5H2,1H3.
What are the key properties of 8-methyl-5,6,8-triazadispiro[2.0.24.33]nonane?
8-methyl-5,6,8-triazadispiro[2.0.24.33]nonane has a molecular weight of 139.20 g/mol, XLogP of -0.48, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyl-5,6,8-triazadispiro[2.0.24.33]nonane is sourced from PubChem (CID 126563217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).