C7H13N3 — CID 126563217
8-methyl-5,6,8-triazadispiro[2.0.24.33]nonane (PubChem CID 126563217) has the molecular formula C7H13N3 and a molecular weight of 139.20 g/mol. Its IUPAC name is 8-methyl-5,6,8-triazadispiro[2.0.24.33]nonane.
| Compound Name | 8-methyl-5,6,8-triazadispiro[2.0.24.33]nonane |
|---|---|
| PubChem CID | 126563217 |
| Molecular Formula | C7H13N3 |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.11 |
| IUPAC Name | 8-methyl-5,6,8-triazadispiro[2.0.24.33]nonane |
| SMILES | CN1CC2(CC2)C2(C1)NN2 |
| InChI | InChI=1S/C7H13N3/c1-10-4-6(2-3-6)7(5-10)8-9-7/h8-9H,2-5H2,1H3 |
| InChIKey | NQUNRKKJILJNPL-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 47.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|